C15H24 — CID 142915182
ethane;2-propan-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 142915182) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is ethane;2-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | ethane;2-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 142915182 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | ethane;2-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC.CC(C)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H18.C2H6/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12;1-2/h3-6,10,12H,7-9H2,1-2H3;1-2H3 |
| InChIKey | RHVAHVVKHXHFEN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |