C16H24 — CID 177260649
(2R)-2,6-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 177260649) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (2R)-2,6-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (2R)-2,6-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 177260649 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (2R)-2,6-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)c1ccc2c(c1)CC[C@@H](C(C)C)C2 |
| InChI | InChI=1S/C16H24/c1-11(2)13-5-7-16-10-14(12(3)4)6-8-15(16)9-13/h5,7,9,11-12,14H,6,8,10H2,1-4H3/t14-/m1/s1 |
| InChIKey | VBJDBASDGFERAM-CQSZACIVSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |