C14H17N — CID 140655860
6-isocyano-2-propan-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 140655860) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 6-isocyano-2-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-isocyano-2-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 140655860 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 6-isocyano-2-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | [C-]#[N+]c1ccc2c(c1)CCC(C(C)C)C2 |
| InChI | InChI=1S/C14H17N/c1-10(2)11-4-5-13-9-14(15-3)7-6-12(13)8-11/h6-7,9-11H,4-5,8H2,1-2H3 |
| InChIKey | LMYWROQGPHNUNF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|