C14H18N2 — CID 168757373
8-isocyano-2-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 168757373) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 8-isocyano-2-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 8-isocyano-2-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 168757373 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 8-isocyano-2-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | [C-]#[N+]c1ccc2c(c1)CN(C(C)C)CCC2 |
| InChI | InChI=1S/C14H18N2/c1-11(2)16-8-4-5-12-6-7-14(15-3)9-13(12)10-16/h6-7,9,11H,4-5,8,10H2,1-2H3 |
| InChIKey | ALXKKYCUUPVIDE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|