C12H13N — CID 159491747
(1S)-7-isocyano-1-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 159491747) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is (1S)-7-isocyano-1-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S)-7-isocyano-1-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 159491747 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (1S)-7-isocyano-1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](C)CCC2 |
| InChI | InChI=1S/C12H13N/c1-9-4-3-5-10-6-7-11(13-2)8-12(9)10/h6-9H,3-5H2,1H3/t9-/m0/s1 |
| InChIKey | UQQJRAOQDNAKSZ-VIFPVBQESA-N |
| XLogP | 3.68 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|