C11H15N — CID 57293578
(8R)-8-methyl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 57293578) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (8R)-8-methyl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | (8R)-8-methyl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 57293578 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (8R)-8-methyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | C[C@@H]1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H15N/c1-8-3-2-4-9-5-6-10(12)7-11(8)9/h5-8H,2-4,12H2,1H3/t8-/m1/s1 |
| InChIKey | QKVNGGXNFRUDRF-MRVPVSSYSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|