C10H14N2 — CID 55277801
(1R)-1,2,3,4-tetrahydronaphthalene-1,7-diamine (PubChem CID 55277801) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (1R)-1,2,3,4-tetrahydronaphthalene-1,7-diamine.
| Compound Name | (1R)-1,2,3,4-tetrahydronaphthalene-1,7-diamine |
|---|---|
| PubChem CID | 55277801 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (1R)-1,2,3,4-tetrahydronaphthalene-1,7-diamine |
| SMILES | Nc1ccc2c(c1)[C@H](N)CCC2 |
| InChI | InChI=1S/C10H14N2/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6,10H,1-3,11-12H2/t10-/m1/s1 |
| InChIKey | FIILISPGQREIBX-SNVBAGLBSA-N |
| XLogP | 1.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|