C14H20O2 — CID 175495891
acetaldehyde;7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 175495891) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is acetaldehyde;7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | acetaldehyde;7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 175495891 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | acetaldehyde;7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC=O.COc1ccc2c(c1)C(C)CCC2 |
| InChI | InChI=1S/C12H16O.C2H4O/c1-9-4-3-5-10-6-7-11(13-2)8-12(9)10;1-2-3/h6-9H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | VIDNBHTXHRGRAD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|