C13H17NO2 — CID 82079561
2-(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 82079561) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 82079561 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)C(CC(N)=O)CCC2 |
| InChI | InChI=1S/C13H17NO2/c1-16-11-6-5-9-3-2-4-10(7-13(14)15)12(9)8-11/h5-6,8,10H,2-4,7H2,1H3,(H2,14,15) |
| InChIKey | YWMGEWWZLXPHQE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |