C14H19BrO — CID 129362608
(1R)-1-(3-bromopropyl)-7-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 129362608) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is (1R)-1-(3-bromopropyl)-7-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R)-1-(3-bromopropyl)-7-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 129362608 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (1R)-1-(3-bromopropyl)-7-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccc2c(c1)[C@@H](CCCBr)CCC2 |
| InChI | InChI=1S/C14H19BrO/c1-16-13-8-7-12-5-2-4-11(6-3-9-15)14(12)10-13/h7-8,10-11H,2-6,9H2,1H3/t11-/m1/s1 |
| InChIKey | ZUVQHJIPORIURZ-LLVKDONJSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|