C13H16O — CID 117281201
1-(3-methyl-2,3-dihydro-1H-inden-5-yl)cyclopropan-1-ol (PubChem CID 117281201) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(3-methyl-2,3-dihydro-1H-inden-5-yl)cyclopropan-1-ol.
| Compound Name | 1-(3-methyl-2,3-dihydro-1H-inden-5-yl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 117281201 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-(3-methyl-2,3-dihydro-1H-inden-5-yl)cyclopropan-1-ol |
| SMILES | CC1CCc2ccc(C3(O)CC3)cc21 |
| InChI | InChI=1S/C13H16O/c1-9-2-3-10-4-5-11(8-12(9)10)13(14)6-7-13/h4-5,8-9,14H,2-3,6-7H2,1H3 |
| InChIKey | FLFUWEAQNYUWQQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |