C16H16O8 — CID 174758249
2-[6-(dicarboxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioic acid (PubChem CID 174758249) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-[6-(dicarboxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioic acid.
| Compound Name | 2-[6-(dicarboxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioic acid |
|---|---|
| PubChem CID | 174758249 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[6-(dicarboxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1ccc2c(c1)CCC(C(C(=O)O)C(=O)O)C2 |
| InChI | InChI=1S/C16H16O8/c17-13(18)11(14(19)20)9-3-1-7-5-10(4-2-8(7)6-9)12(15(21)22)16(23)24/h1,3,6,10-12H,2,4-5H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | HMBMXJUBIRFFBH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|