C14H18O2 — CID 142773351
2-(1,2,3,4-tetrahydronaphthalen-2-yl)butanoic acid (PubChem CID 142773351) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-2-yl)butanoic acid.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 142773351 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H18O2/c1-2-13(14(15)16)12-8-7-10-5-3-4-6-11(10)9-12/h3-6,12-13H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | RPKYULJTGLXUSX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |