About 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride
1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride (PubChem CID 67808987) has the molecular formula C11H13ClO2
and a molecular weight of 212.68 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride.
Analyze 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride?
The IUPAC name of 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride (CID 67808987) is 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride?
The canonical SMILES for 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCc2ccccc2C1.
What is the InChIKey of 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride?
The InChIKey is XHPSBBQPZKCKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.ClH/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h1-4,10H,5-7H2,(H,12,13);1H.
What are the key properties of 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride?
1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride has a molecular weight of 212.68 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 67808987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).