C39H39NO2 — CID 139892813
tetrabenzylazanium;1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 139892813) has the molecular formula C39H39NO2 and a molecular weight of 553.75 g/mol. Its IUPAC name is tetrabenzylazanium;1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | tetrabenzylazanium;1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139892813 |
| Molecular Formula | C39H39NO2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | tetrabenzylazanium;1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | O=C([O-])C1CCc2ccccc2C1.c1ccc(C[N+](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N.C11H12O2/c1-5-13-25(14-6-1)21-29(22-26-15-7-2-8-16-26,23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28;12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-20H,21-24H2;1-4,10H,5-7H2,(H,12,13)/q+1;/p-1 |
| InChIKey | TWHTYBLWJLOAHO-UHFFFAOYSA-M |
| XLogP | 7.15 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|