C13H19NO2 — CID 178025111
2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid;ethane (PubChem CID 178025111) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid;ethane.
| Compound Name | 2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid;ethane |
|---|---|
| PubChem CID | 178025111 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetic acid;ethane |
| SMILES | CC.NC(C(=O)O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13NO2.C2H6/c12-10(11(13)14)9-5-7-3-1-2-4-8(7)6-9;1-2/h1-4,9-10H,5-6,12H2,(H,13,14);1-2H3 |
| InChIKey | HLOKYVKKAQUGRV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |