C6H9NO3 — CID 121208056
2-amino-2-(3-oxocyclobutyl)acetic acid (PubChem CID 121208056) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-amino-2-(3-oxocyclobutyl)acetic acid.
| Compound Name | 2-amino-2-(3-oxocyclobutyl)acetic acid |
|---|---|
| PubChem CID | 121208056 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2-amino-2-(3-oxocyclobutyl)acetic acid |
| SMILES | NC(C(=O)O)C1CC(=O)C1 |
| InChI | InChI=1S/C6H9NO3/c7-5(6(9)10)3-1-4(8)2-3/h3,5H,1-2,7H2,(H,9,10) |
| InChIKey | CSLGAHOPMYPZGP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |