2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid

C11H22N2O2 — CID 57096388

IUPAC2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid
SMILESCC1(C)CC(C(N)C(=O)O)CC(C)(C)N1
InChIInChI=1S/C11H22N2O2/c1-10(2)5-7(8(12)9(14)15)6-11(3,4)13-10/h7-8,13H,5-6,12H2,1-4H3,(H,14,15)
InChIKeyFIFNVTJVCQDQOT-UHFFFAOYSA-N
MW214.31 g/mol
LogP0.96
Rot. Bonds2

About 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid

2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid (PubChem CID 57096388) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid
PubChem CID57096388
Molecular FormulaC11H22N2O2
Molecular Weight214.31 g/mol
Exact Mass214.17
IUPAC Name2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid
SMILESCC1(C)CC(C(N)C(=O)O)CC(C)(C)N1
InChIInChI=1S/C11H22N2O2/c1-10(2)5-7(8(12)9(14)15)6-11(3,4)13-10/h7-8,13H,5-6,12H2,1-4H3,(H,14,15)
InChIKeyFIFNVTJVCQDQOT-UHFFFAOYSA-N
XLogP0.96
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 50.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid?
The IUPAC name of 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid (CID 57096388) is 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid?
The canonical SMILES for 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid is CC1(C)CC(C(N)C(=O)O)CC(C)(C)N1.
What is the InChIKey of 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid?
The InChIKey is FIFNVTJVCQDQOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-10(2)5-7(8(12)9(14)15)6-11(3,4)13-10/h7-8,13H,5-6,12H2,1-4H3,(H,14,15).
What are the key properties of 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid?
2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid has a molecular weight of 214.31 g/mol, XLogP of 0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetic acid is sourced from PubChem (CID 57096388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).