C12H13NO2 — CID 97304435
(2R)-2-amino-2-[(2S)-1,2-dihydronaphthalen-2-yl]acetic acid (PubChem CID 97304435) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2R)-2-amino-2-[(2S)-1,2-dihydronaphthalen-2-yl]acetic acid.
| Compound Name | (2R)-2-amino-2-[(2S)-1,2-dihydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 97304435 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2R)-2-amino-2-[(2S)-1,2-dihydronaphthalen-2-yl]acetic acid |
| SMILES | N[C@@H](C(=O)O)[C@@H]1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C12H13NO2/c13-11(12(14)15)10-6-5-8-3-1-2-4-9(8)7-10/h1-6,10-11H,7,13H2,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | DPSNYXFGTTYDTH-GHMZBOCLSA-N |
| XLogP | 1.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |