C10H10O — CID 12963098
(2R)-1,2-dihydronaphthalen-2-ol (PubChem CID 12963098) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is (2R)-1,2-dihydronaphthalen-2-ol.
| Compound Name | (2R)-1,2-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 12963098 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (2R)-1,2-dihydronaphthalen-2-ol |
| SMILES | O[C@H]1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C10H10O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-6,10-11H,7H2/t10-/m0/s1 |
| InChIKey | KBILEKAHWIGRSO-JTQLQIEISA-N |
| XLogP | 1.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |