C18H17NO2 — CID 165348255
1,2-dihydronaphthalen-2-ylmethyl N-phenylcarbamate (PubChem CID 165348255) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1,2-dihydronaphthalen-2-ylmethyl N-phenylcarbamate.
| Compound Name | 1,2-dihydronaphthalen-2-ylmethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 165348255 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1,2-dihydronaphthalen-2-ylmethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCC1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C18H17NO2/c20-18(19-17-8-2-1-3-9-17)21-13-14-10-11-15-6-4-5-7-16(15)12-14/h1-11,14H,12-13H2,(H,19,20) |
| InChIKey | HKRMATUZYHZVDC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |