C12H11NO4 — CID 12706673
(5-oxo-2H-furan-2-yl)methyl N-phenylcarbamate (PubChem CID 12706673) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is (5-oxo-2H-furan-2-yl)methyl N-phenylcarbamate.
| Compound Name | (5-oxo-2H-furan-2-yl)methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 12706673 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (5-oxo-2H-furan-2-yl)methyl N-phenylcarbamate |
| SMILES | O=C1C=CC(COC(=O)Nc2ccccc2)O1 |
| InChI | InChI=1S/C12H11NO4/c14-11-7-6-10(17-11)8-16-12(15)13-9-4-2-1-3-5-9/h1-7,10H,8H2,(H,13,15) |
| InChIKey | LZDRLKQMFAAAAR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |