C20H22N2O6 — CID 162736902
(4-methyl-5-oxooxolan-2-yl)methyl N-phenylcarbamate;phenylcarbamic acid (PubChem CID 162736902) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is (4-methyl-5-oxooxolan-2-yl)methyl N-phenylcarbamate;phenylcarbamic acid.
| Compound Name | (4-methyl-5-oxooxolan-2-yl)methyl N-phenylcarbamate;phenylcarbamic acid |
|---|---|
| PubChem CID | 162736902 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (4-methyl-5-oxooxolan-2-yl)methyl N-phenylcarbamate;phenylcarbamic acid |
| SMILES | CC1CC(COC(=O)Nc2ccccc2)OC1=O.O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C13H15NO4.C7H7NO2/c1-9-7-11(18-12(9)15)8-17-13(16)14-10-5-3-2-4-6-10;9-7(10)8-6-4-2-1-3-5-6/h2-6,9,11H,7-8H2,1H3,(H,14,16);1-5,8H,(H,9,10) |
| InChIKey | LPLCKVQSDFWQPW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |