C20H22N2O3 — CID 101157575
[(2S,4S)-4-(4-methylphenyl)-6-oxopiperidin-2-yl]methyl N-phenylcarbamate (PubChem CID 101157575) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is [(2S,4S)-4-(4-methylphenyl)-6-oxopiperidin-2-yl]methyl N-phenylcarbamate.
| Compound Name | [(2S,4S)-4-(4-methylphenyl)-6-oxopiperidin-2-yl]methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 101157575 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [(2S,4S)-4-(4-methylphenyl)-6-oxopiperidin-2-yl]methyl N-phenylcarbamate |
| SMILES | Cc1ccc([C@@H]2CC(=O)N[C@H](COC(=O)Nc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-14-7-9-15(10-8-14)16-11-18(21-19(23)12-16)13-25-20(24)22-17-5-3-2-4-6-17/h2-10,16,18H,11-13H2,1H3,(H,21,23)(H,22,24)/t16-,18-/m0/s1 |
| InChIKey | SDQWRHCMWZFKNW-WMZOPIPTSA-N |
| XLogP | 3.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |