C15H22N2O2 — CID 79336958
[2-(aminomethyl)cyclopentyl]methyl N-(3-methylphenyl)carbamate (PubChem CID 79336958) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is [2-(aminomethyl)cyclopentyl]methyl N-(3-methylphenyl)carbamate.
| Compound Name | [2-(aminomethyl)cyclopentyl]methyl N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 79336958 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [2-(aminomethyl)cyclopentyl]methyl N-(3-methylphenyl)carbamate |
| SMILES | Cc1cccc(NC(=O)OCC2CCCC2CN)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-11-4-2-7-14(8-11)17-15(18)19-10-13-6-3-5-12(13)9-16/h2,4,7-8,12-13H,3,5-6,9-10,16H2,1H3,(H,17,18) |
| InChIKey | SNPMRPCKOHVOMT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |