C18H20O6 — CID 142300994
(4-methyl-5-oxooxolan-2-yl)methyl prop-2-enoate;(E)-3-phenylprop-2-enoic acid (PubChem CID 142300994) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is (4-methyl-5-oxooxolan-2-yl)methyl prop-2-enoate;(E)-3-phenylprop-2-enoic acid.
| Compound Name | (4-methyl-5-oxooxolan-2-yl)methyl prop-2-enoate;(E)-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 142300994 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (4-methyl-5-oxooxolan-2-yl)methyl prop-2-enoate;(E)-3-phenylprop-2-enoic acid |
| SMILES | C=CC(=O)OCC1CC(C)C(=O)O1.O=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H12O4.C9H8O2/c1-3-8(10)12-5-7-4-6(2)9(11)13-7;10-9(11)7-6-8-4-2-1-3-5-8/h3,6-7H,1,4-5H2,2H3;1-7H,(H,10,11)/b;7-6+ |
| InChIKey | XHMVRIGUYXUAOM-UETGHTDLSA-N |
| XLogP | 2.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|