C17H18N2O8S2 — CID 102406993
(2-oxo-1,3-oxathiolan-5-yl)methyl N-[2-methyl-5-[(2-oxo-1,3-oxathiolan-5-yl)methoxycarbonylamino]phenyl]carbamate (PubChem CID 102406993) has the molecular formula C17H18N2O8S2 and a molecular weight of 442.47 g/mol. Its IUPAC name is (2-oxo-1,3-oxathiolan-5-yl)methyl N-[2-methyl-5-[(2-oxo-1,3-oxathiolan-5-yl)methoxycarbonylamino]phenyl]carbamate.
| Compound Name | (2-oxo-1,3-oxathiolan-5-yl)methyl N-[2-methyl-5-[(2-oxo-1,3-oxathiolan-5-yl)methoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 102406993 |
| Molecular Formula | C17H18N2O8S2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (2-oxo-1,3-oxathiolan-5-yl)methyl N-[2-methyl-5-[(2-oxo-1,3-oxathiolan-5-yl)methoxycarbonylamino]phenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OCC2CSC(=O)O2)cc1NC(=O)OCC1CSC(=O)O1 |
| InChI | InChI=1S/C17H18N2O8S2/c1-9-2-3-10(18-14(20)24-5-11-7-28-16(22)26-11)4-13(9)19-15(21)25-6-12-8-29-17(23)27-12/h2-4,11-12H,5-8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | QTSLYHIOCDYCPM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|