C30H30Cl3N3O8 — CID 139212217
[(2S,4R,5R,6R)-4,5-bis[(3-chloro-4-methylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3-chloro-4-methylphenyl)carbamate (PubChem CID 139212217) has the molecular formula C30H30Cl3N3O8 and a molecular weight of 666.94 g/mol. Its IUPAC name is [(2S,4R,5R,6R)-4,5-bis[(3-chloro-4-methylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3-chloro-4-methylphenyl)carbamate.
| Compound Name | [(2S,4R,5R,6R)-4,5-bis[(3-chloro-4-methylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3-chloro-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 139212217 |
| Molecular Formula | C30H30Cl3N3O8 |
| Molecular Weight | 666.94 g/mol |
| Exact Mass | 665.11 |
| IUPAC Name | [(2S,4R,5R,6R)-4,5-bis[(3-chloro-4-methylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3-chloro-4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OC[C@@H]2C[C@@H](OC(=O)Nc3ccc(C)c(Cl)c3)[C@@H](OC(=O)Nc3ccc(C)c(Cl)c3)[C@H](O)O2)cc1Cl |
| InChI | InChI=1S/C30H30Cl3N3O8/c1-15-4-7-18(10-22(15)31)34-28(38)41-14-21-13-25(43-29(39)35-19-8-5-16(2)23(32)11-19)26(27(37)42-21)44-30(40)36-20-9-6-17(3)24(33)12-20/h4-12,21,25-27,37H,13-14H2,1-3H3,(H,34,38)(H,35,39)(H,36,40)/t21-,25+,26+,27+/m0/s1 |
| InChIKey | IHGAHWAIMRCWGT-IZIBRLFBSA-N |
| XLogP | 7.46 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.94 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|