C20H29N3O10Si — CID 87362178
2-[dimethoxy(methyl)silyl]ethyl N-[3,4-bis(oxiran-2-ylmethoxycarbonylamino)phenyl]carbamate (PubChem CID 87362178) has the molecular formula C20H29N3O10Si and a molecular weight of 499.55 g/mol. Its IUPAC name is 2-[dimethoxy(methyl)silyl]ethyl N-[3,4-bis(oxiran-2-ylmethoxycarbonylamino)phenyl]carbamate.
| Compound Name | 2-[dimethoxy(methyl)silyl]ethyl N-[3,4-bis(oxiran-2-ylmethoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 87362178 |
| Molecular Formula | C20H29N3O10Si |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 2-[dimethoxy(methyl)silyl]ethyl N-[3,4-bis(oxiran-2-ylmethoxycarbonylamino)phenyl]carbamate |
| SMILES | CO[Si](C)(CCOC(=O)Nc1ccc(NC(=O)OCC2CO2)c(NC(=O)OCC2CO2)c1)OC |
| InChI | InChI=1S/C20H29N3O10Si/c1-27-34(3,28-2)7-6-29-18(24)21-13-4-5-16(22-19(25)32-11-14-9-30-14)17(8-13)23-20(26)33-12-15-10-31-15/h4-5,8,14-15H,6-7,9-12H2,1-3H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | DXADIFLMKZKNLJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|