C27H48Cl3NO9Si — CID 159085235
1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-trichlorosilylpentoxy)phenyl]carbamate;methane (PubChem CID 159085235) has the molecular formula C27H48Cl3NO9Si and a molecular weight of 665.12 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-trichlorosilylpentoxy)phenyl]carbamate;methane.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-trichlorosilylpentoxy)phenyl]carbamate;methane |
|---|---|
| PubChem CID | 159085235 |
| Molecular Formula | C27H48Cl3NO9Si |
| Molecular Weight | 665.12 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-trichlorosilylpentoxy)phenyl]carbamate;methane |
| SMILES | C.C.O=C(Nc1ccc(OCCCCC[Si](Cl)(Cl)Cl)cc1)OCC1COCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C25H40Cl3NO9Si.2CH4/c26-39(27,28)19-3-1-2-8-36-23-6-4-22(5-7-23)29-25(30)38-21-24-20-35-16-15-33-12-11-31-9-10-32-13-14-34-17-18-37-24;;/h4-7,24H,1-3,8-21H2,(H,29,30);2*1H4 |
| InChIKey | KBJDBLPZTQUTIO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.12 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|