C25H39NO9 — CID 58886809
1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-(4-pent-4-enoxyphenyl)carbamate (PubChem CID 58886809) has the molecular formula C25H39NO9 and a molecular weight of 497.59 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-(4-pent-4-enoxyphenyl)carbamate.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-(4-pent-4-enoxyphenyl)carbamate |
|---|---|
| PubChem CID | 58886809 |
| Molecular Formula | C25H39NO9 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-(4-pent-4-enoxyphenyl)carbamate |
| SMILES | C=CCCCOc1ccc(NC(=O)OCC2COCCOCCOCCOCCOCCO2)cc1 |
| InChI | InChI=1S/C25H39NO9/c1-2-3-4-9-33-23-7-5-22(6-8-23)26-25(27)35-21-24-20-32-17-16-30-13-12-28-10-11-29-14-15-31-18-19-34-24/h2,5-8,24H,1,3-4,9-21H2,(H,26,27) |
| InChIKey | DXTVVPHBMQQUBG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|