C14H16F3NO4 — CID 94796306
2,2,2-trifluoroethyl N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]carbamate (PubChem CID 94796306) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 94796306 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(OC[C@@H]2CCCO2)cc1)OCC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO4/c15-14(16,17)9-22-13(19)18-10-3-5-11(6-4-10)21-8-12-2-1-7-20-12/h3-6,12H,1-2,7-9H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | RQEDHLZTGAIREO-LBPRGKRZSA-N |
| XLogP | 3.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |