C14H18N2O4 — CID 71370344
N-[4-(oxiran-2-ylmethoxy)phenyl]morpholine-4-carboxamide (PubChem CID 71370344) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[4-(oxiran-2-ylmethoxy)phenyl]morpholine-4-carboxamide.
| Compound Name | N-[4-(oxiran-2-ylmethoxy)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 71370344 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[4-(oxiran-2-ylmethoxy)phenyl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCC2CO2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C14H18N2O4/c17-14(16-5-7-18-8-6-16)15-11-1-3-12(4-2-11)19-9-13-10-20-13/h1-4,13H,5-10H2,(H,15,17) |
| InChIKey | UCYVOPKVSOBYLZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|