C20H25N5O3 — CID 134813193
N-[4-(oxolan-2-ylmethoxy)phenyl]-4-pyridazin-3-ylpiperazine-1-carboxamide (PubChem CID 134813193) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[4-(oxolan-2-ylmethoxy)phenyl]-4-pyridazin-3-ylpiperazine-1-carboxamide.
| Compound Name | N-[4-(oxolan-2-ylmethoxy)phenyl]-4-pyridazin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 134813193 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[4-(oxolan-2-ylmethoxy)phenyl]-4-pyridazin-3-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OCC2CCCO2)cc1)N1CCN(c2cccnn2)CC1 |
| InChI | InChI=1S/C20H25N5O3/c26-20(25-12-10-24(11-13-25)19-4-1-9-21-23-19)22-16-5-7-17(8-6-16)28-15-18-3-2-14-27-18/h1,4-9,18H,2-3,10-15H2,(H,22,26) |
| InChIKey | OJLBVJHXAXPZJN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |