C29H49NO9S — CID 58886810
1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-butylsulfanylpentoxy)phenyl]carbamate (PubChem CID 58886810) has the molecular formula C29H49NO9S and a molecular weight of 587.78 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-butylsulfanylpentoxy)phenyl]carbamate.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-butylsulfanylpentoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 58886810 |
| Molecular Formula | C29H49NO9S |
| Molecular Weight | 587.78 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl N-[4-(5-butylsulfanylpentoxy)phenyl]carbamate |
| SMILES | CCCCSCCCCCOc1ccc(NC(=O)OCC2COCCOCCOCCOCCOCCO2)cc1 |
| InChI | InChI=1S/C29H49NO9S/c1-2-3-22-40-23-6-4-5-11-37-27-9-7-26(8-10-27)30-29(31)39-25-28-24-36-19-18-34-15-14-32-12-13-33-16-17-35-20-21-38-28/h7-10,28H,2-6,11-25H2,1H3,(H,30,31) |
| InChIKey | GBNPGDQOOCNEQP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|