About hydrogen peroxide;1H-indene;hydrobromide
hydrogen peroxide;1H-indene;hydrobromide (PubChem CID 158452751) has the molecular formula C9H11BrO2
and a molecular weight of 231.09 g/mol. Its IUPAC name is hydrogen peroxide;1H-indene;hydrobromide.
Molecular Properties
| Compound Name | hydrogen peroxide;1H-indene;hydrobromide |
| PubChem CID | 158452751 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | hydrogen peroxide;1H-indene;hydrobromide |
| SMILES | Br.C1=Cc2ccccc2C1.OO |
| InChI | InChI=1S/C9H8.BrH.H2O2/c1-2-5-9-7-3-6-8(9)4-1;;1-2/h1-6H,7H2;1H;1-2H |
| InChIKey | HEETYOLTNZGFTM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;1H-indene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;1H-indene;hydrobromide?
The IUPAC name of hydrogen peroxide;1H-indene;hydrobromide (CID 158452751) is hydrogen peroxide;1H-indene;hydrobromide.
What is the SMILES notation for hydrogen peroxide;1H-indene;hydrobromide?
The canonical SMILES for hydrogen peroxide;1H-indene;hydrobromide is Br.C1=Cc2ccccc2C1.OO.
What is the InChIKey of hydrogen peroxide;1H-indene;hydrobromide?
The InChIKey is HEETYOLTNZGFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.BrH.H2O2/c1-2-5-9-7-3-6-8(9)4-1;;1-2/h1-6H,7H2;1H;1-2H.
What are the key properties of hydrogen peroxide;1H-indene;hydrobromide?
hydrogen peroxide;1H-indene;hydrobromide has a molecular weight of 231.09 g/mol, XLogP of 2.85, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;1H-indene;hydrobromide is sourced from PubChem (CID 158452751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).