About 1H-indene;pyrazine
1H-indene;pyrazine (PubChem CID 175286554) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1H-indene;pyrazine.
Molecular Properties
| Compound Name | 1H-indene;pyrazine |
| PubChem CID | 175286554 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1H-indene;pyrazine |
| SMILES | C1=Cc2ccccc2C1.c1cnccn1 |
| InChI | InChI=1S/C9H8.C4H4N2/c1-2-5-9-7-3-6-8(9)4-1;1-2-6-4-3-5-1/h1-6H,7H2;1-4H |
| InChIKey | HUXUTVNQUVYYRR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indene;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;pyrazine?
The IUPAC name of 1H-indene;pyrazine (CID 175286554) is 1H-indene;pyrazine.
What is the SMILES notation for 1H-indene;pyrazine?
The canonical SMILES for 1H-indene;pyrazine is C1=Cc2ccccc2C1.c1cnccn1.
What is the InChIKey of 1H-indene;pyrazine?
The InChIKey is HUXUTVNQUVYYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C4H4N2/c1-2-5-9-7-3-6-8(9)4-1;1-2-6-4-3-5-1/h1-6H,7H2;1-4H.
What are the key properties of 1H-indene;pyrazine?
1H-indene;pyrazine has a molecular weight of 196.25 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;pyrazine is sourced from PubChem (CID 175286554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).