About copper;1H-indene
copper;1H-indene (PubChem CID 175216856) has the molecular formula C9H8Cu
and a molecular weight of 179.71 g/mol. Its IUPAC name is copper;1H-indene.
Molecular Properties
| Compound Name | copper;1H-indene |
| PubChem CID | 175216856 |
| Molecular Formula | C9H8Cu |
| Molecular Weight | 179.71 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | copper;1H-indene |
| SMILES | C1=Cc2ccccc2C1.[Cu] |
| InChI | InChI=1S/C9H8.Cu/c1-2-5-9-7-3-6-8(9)4-1;/h1-6H,7H2; |
| InChIKey | PVVWOXOLONHABV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze copper;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1H-indene?
The IUPAC name of copper;1H-indene (CID 175216856) is copper;1H-indene.
What is the SMILES notation for copper;1H-indene?
The canonical SMILES for copper;1H-indene is C1=Cc2ccccc2C1.[Cu].
What is the InChIKey of copper;1H-indene?
The InChIKey is PVVWOXOLONHABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.Cu/c1-2-5-9-7-3-6-8(9)4-1;/h1-6H,7H2;.
What are the key properties of copper;1H-indene?
copper;1H-indene has a molecular weight of 179.71 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1H-indene is sourced from PubChem (CID 175216856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).