About azulene;1H-indene
azulene;1H-indene (PubChem CID 160524105) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is azulene;1H-indene.
Molecular Properties
| Compound Name | azulene;1H-indene |
| PubChem CID | 160524105 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | azulene;1H-indene |
| SMILES | C1=Cc2ccccc2C1.c1ccc2cccc-2cc1 |
| InChI | InChI=1S/C10H8.C9H8/c1-2-5-9-7-4-8-10(9)6-3-1;1-2-5-9-7-3-6-8(9)4-1/h1-8H;1-6H,7H2 |
| InChIKey | QUQZPDJOTCHPHG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze azulene;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene;1H-indene?
The IUPAC name of azulene;1H-indene (CID 160524105) is azulene;1H-indene.
What is the SMILES notation for azulene;1H-indene?
The canonical SMILES for azulene;1H-indene is C1=Cc2ccccc2C1.c1ccc2cccc-2cc1.
What is the InChIKey of azulene;1H-indene?
The InChIKey is QUQZPDJOTCHPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C9H8/c1-2-5-9-7-4-8-10(9)6-3-1;1-2-5-9-7-3-6-8(9)4-1/h1-8H;1-6H,7H2.
What are the key properties of azulene;1H-indene?
azulene;1H-indene has a molecular weight of 244.34 g/mol, XLogP of 5.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azulene;1H-indene is sourced from PubChem (CID 160524105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).