About 1H-indene;methane
1H-indene;methane (PubChem CID 22114429) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is 1H-indene;methane.
Molecular Properties
| Compound Name | 1H-indene;methane |
| PubChem CID | 22114429 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1H-indene;methane |
| SMILES | C.C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C9H8.CH4/c1-2-5-9-7-3-6-8(9)4-1;/h1-6H,7H2;1H4 |
| InChIKey | YKPWFBDMFYSXLS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;methane?
The IUPAC name of 1H-indene;methane (CID 22114429) is 1H-indene;methane.
What is the SMILES notation for 1H-indene;methane?
The canonical SMILES for 1H-indene;methane is C.C1=Cc2ccccc2C1.
What is the InChIKey of 1H-indene;methane?
The InChIKey is YKPWFBDMFYSXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.CH4/c1-2-5-9-7-3-6-8(9)4-1;/h1-6H,7H2;1H4.
What are the key properties of 1H-indene;methane?
1H-indene;methane has a molecular weight of 132.21 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;methane is sourced from PubChem (CID 22114429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).