About ethoxyethane;1H-indene
ethoxyethane;1H-indene (PubChem CID 86747629) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is ethoxyethane;1H-indene.
Molecular Properties
| Compound Name | ethoxyethane;1H-indene |
| PubChem CID | 86747629 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | ethoxyethane;1H-indene |
| SMILES | C1=Cc2ccccc2C1.CCOCC |
| InChI | InChI=1S/C9H8.C4H10O/c1-2-5-9-7-3-6-8(9)4-1;1-3-5-4-2/h1-6H,7H2;3-4H2,1-2H3 |
| InChIKey | SXHAWXOVYLXIEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethoxyethane;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;1H-indene?
The IUPAC name of ethoxyethane;1H-indene (CID 86747629) is ethoxyethane;1H-indene.
What is the SMILES notation for ethoxyethane;1H-indene?
The canonical SMILES for ethoxyethane;1H-indene is C1=Cc2ccccc2C1.CCOCC.
What is the InChIKey of ethoxyethane;1H-indene?
The InChIKey is SXHAWXOVYLXIEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C4H10O/c1-2-5-9-7-3-6-8(9)4-1;1-3-5-4-2/h1-6H,7H2;3-4H2,1-2H3.
What are the key properties of ethoxyethane;1H-indene?
ethoxyethane;1H-indene has a molecular weight of 190.29 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;1H-indene is sourced from PubChem (CID 86747629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).