C28H26 — CID 161039487
2,3-dihydro-1H-indene;1H-indene;naphthalene (PubChem CID 161039487) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;1H-indene;naphthalene.
| Compound Name | 2,3-dihydro-1H-indene;1H-indene;naphthalene |
|---|---|
| PubChem CID | 161039487 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2,3-dihydro-1H-indene;1H-indene;naphthalene |
| SMILES | C1=Cc2ccccc2C1.c1ccc2c(c1)CCC2.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H10.C9H8/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-2-5-9-7-3-6-8(9)4-1/h1-8H;1-2,4-5H,3,6-7H2;1-6H,7H2 |
| InChIKey | UARUHLQESUCFPK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |