About 1,4-diphenylbenzene;1H-indene
1,4-diphenylbenzene;1H-indene (PubChem CID 156634731) has the molecular formula C27H22
and a molecular weight of 346.47 g/mol. Its IUPAC name is 1,4-diphenylbenzene;1H-indene.
Molecular Properties
| Compound Name | 1,4-diphenylbenzene;1H-indene |
| PubChem CID | 156634731 |
| Molecular Formula | C27H22 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1,4-diphenylbenzene;1H-indene |
| SMILES | C1=Cc2ccccc2C1.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14.C9H8/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;1-2-5-9-7-3-6-8(9)4-1/h1-14H;1-6H,7H2 |
| InChIKey | RIWCQYNWFSCUFV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-diphenylbenzene;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diphenylbenzene;1H-indene?
The IUPAC name of 1,4-diphenylbenzene;1H-indene (CID 156634731) is 1,4-diphenylbenzene;1H-indene.
What is the SMILES notation for 1,4-diphenylbenzene;1H-indene?
The canonical SMILES for 1,4-diphenylbenzene;1H-indene is C1=Cc2ccccc2C1.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of 1,4-diphenylbenzene;1H-indene?
The InChIKey is RIWCQYNWFSCUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14.C9H8/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;1-2-5-9-7-3-6-8(9)4-1/h1-14H;1-6H,7H2.
What are the key properties of 1,4-diphenylbenzene;1H-indene?
1,4-diphenylbenzene;1H-indene has a molecular weight of 346.47 g/mol, XLogP of 7.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diphenylbenzene;1H-indene is sourced from PubChem (CID 156634731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).