C19H22 — CID 156719082
ethane;(2Z)-10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaene (PubChem CID 156719082) has the molecular formula C19H22 and a molecular weight of 250.39 g/mol. Its IUPAC name is ethane;(2Z)-10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaene.
| Compound Name | ethane;(2Z)-10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 156719082 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;(2Z)-10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaene |
| SMILES | CC.CC1Cc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C17H16.C2H6/c1-13-12-16-8-3-2-6-14(16)10-11-15-7-4-5-9-17(13)15;1-2/h2-11,13H,12H2,1H3;1-2H3/b11-10-; |
| InChIKey | KEDYQADIJCPEAU-GMFCBQQYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|