C16H14N2 — CID 10704860
2-methyl-10,12-diazatricyclo[11.4.0.04,9]heptadeca-1(17),4,6,8,10,11,13,15-octaene (PubChem CID 10704860) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methyl-10,12-diazatricyclo[11.4.0.04,9]heptadeca-1(17),4,6,8,10,11,13,15-octaene.
| Compound Name | 2-methyl-10,12-diazatricyclo[11.4.0.04,9]heptadeca-1(17),4,6,8,10,11,13,15-octaene |
|---|---|
| PubChem CID | 10704860 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-methyl-10,12-diazatricyclo[11.4.0.04,9]heptadeca-1(17),4,6,8,10,11,13,15-octaene |
| SMILES | CC1Cc2ccccc2N=C=Nc2ccccc21 |
| InChI | InChI=1S/C16H14N2/c1-12-10-13-6-2-4-8-15(13)17-11-18-16-9-5-3-7-14(12)16/h2-9,12H,10H2,1H3 |
| InChIKey | KQAPMBIEQPFPKW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |