C17H17Cl — CID 102268560
7-chloro-2-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene (PubChem CID 102268560) has the molecular formula C17H17Cl and a molecular weight of 256.78 g/mol. Its IUPAC name is 7-chloro-2-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene.
| Compound Name | 7-chloro-2-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene |
|---|---|
| PubChem CID | 102268560 |
| Molecular Formula | C17H17Cl |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 7-chloro-2-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene |
| SMILES | CC1Cc2ccc(Cl)cc2CCc2ccccc21 |
| InChI | InChI=1S/C17H17Cl/c1-12-10-14-8-9-16(18)11-15(14)7-6-13-4-2-3-5-17(12)13/h2-5,8-9,11-12H,6-7,10H2,1H3 |
| InChIKey | ODCAEKYBMIGIGP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |