C16H15Cl — CID 142258016
6-chloro-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene (PubChem CID 142258016) has the molecular formula C16H15Cl and a molecular weight of 242.75 g/mol. Its IUPAC name is 6-chloro-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene.
| Compound Name | 6-chloro-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 142258016 |
| Molecular Formula | C16H15Cl |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6-chloro-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
| SMILES | CC1c2ccccc2CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H15Cl/c1-11-15-5-3-2-4-12(15)6-7-13-10-14(17)8-9-16(11)13/h2-5,8-11H,6-7H2,1H3 |
| InChIKey | ZMKBEKINQPFHGF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |