C16H17Cl3 — CID 123268998
3,8,9-trichloro-7,12-dimethyl-5,6,11,12-tetrahydrobenzo[10]annulene (PubChem CID 123268998) has the molecular formula C16H17Cl3 and a molecular weight of 315.67 g/mol. Its IUPAC name is 3,8,9-trichloro-7,12-dimethyl-5,6,11,12-tetrahydrobenzo[10]annulene.
| Compound Name | 3,8,9-trichloro-7,12-dimethyl-5,6,11,12-tetrahydrobenzo[10]annulene |
|---|---|
| PubChem CID | 123268998 |
| Molecular Formula | C16H17Cl3 |
| Molecular Weight | 315.67 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3,8,9-trichloro-7,12-dimethyl-5,6,11,12-tetrahydrobenzo[10]annulene |
| SMILES | CC1=C(Cl)C(Cl)=CCC(C)c2ccc(Cl)cc2CC1 |
| InChI | InChI=1S/C16H17Cl3/c1-10-4-8-15(18)16(19)11(2)3-5-12-9-13(17)6-7-14(10)12/h6-10H,3-5H2,1-2H3 |
| InChIKey | JDEITMSJRPGRMU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |