C20H24ClN2+ — CID 90475714
1-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,1-dimethylazetidin-1-ium-3-amine (PubChem CID 90475714) has the molecular formula C20H24ClN2+ and a molecular weight of 327.88 g/mol. Its IUPAC name is 1-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,1-dimethylazetidin-1-ium-3-amine.
| Compound Name | 1-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,1-dimethylazetidin-1-ium-3-amine |
|---|---|
| PubChem CID | 90475714 |
| Molecular Formula | C20H24ClN2+ |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N,1-dimethylazetidin-1-ium-3-amine |
| SMILES | CNC1C[N+](C)(C2c3ccccc3CCc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C20H24ClN2/c1-22-17-12-23(2,13-17)20-18-6-4-3-5-14(18)7-8-15-9-10-16(21)11-19(15)20/h3-6,9-11,17,20,22H,7-8,12-13H2,1-2H3/q+1 |
| InChIKey | SYTGULYERQOWFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|