C13H14O — CID 102399730
(5Z)-10-methyl-9,10-dihydro-8H-benzo[8]annulen-7-one (PubChem CID 102399730) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (5Z)-10-methyl-9,10-dihydro-8H-benzo[8]annulen-7-one.
| Compound Name | (5Z)-10-methyl-9,10-dihydro-8H-benzo[8]annulen-7-one |
|---|---|
| PubChem CID | 102399730 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (5Z)-10-methyl-9,10-dihydro-8H-benzo[8]annulen-7-one |
| SMILES | CC1CCC(=O)/C=C\c2ccccc21 |
| InChI | InChI=1S/C13H14O/c1-10-6-8-12(14)9-7-11-4-2-3-5-13(10)11/h2-5,7,9-10H,6,8H2,1H3/b9-7- |
| InChIKey | BQLFZAVSIFBZEH-CLFYSBASSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |